C17H33N — CID 143993396
ethane;4-methyl-N,N-dipropylaniline (PubChem CID 143993396) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is ethane;4-methyl-N,N-dipropylaniline.
| Compound Name | ethane;4-methyl-N,N-dipropylaniline |
|---|---|
| PubChem CID | 143993396 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | ethane;4-methyl-N,N-dipropylaniline |
| SMILES | CC.CC.CCCN(CCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H21N.2C2H6/c1-4-10-14(11-5-2)13-8-6-12(3)7-9-13;2*1-2/h6-9H,4-5,10-11H2,1-3H3;2*1-2H3 |
| InChIKey | DUGIUPHACWAZCF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|