C20H28ClN — CID 142864428
1-chloro-4-methylbenzene;4-methyl-N,N-dipropylaniline (PubChem CID 142864428) has the molecular formula C20H28ClN and a molecular weight of 317.90 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;4-methyl-N,N-dipropylaniline.
| Compound Name | 1-chloro-4-methylbenzene;4-methyl-N,N-dipropylaniline |
|---|---|
| PubChem CID | 142864428 |
| Molecular Formula | C20H28ClN |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-chloro-4-methylbenzene;4-methyl-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(C)cc1.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H21N.C7H7Cl/c1-4-10-14(11-5-2)13-8-6-12(3)7-9-13;1-6-2-4-7(8)5-3-6/h6-9H,4-5,10-11H2,1-3H3;2-5H,1H3 |
| InChIKey | OKHWVVCNMKHNBC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|