C13H20ClN — CID 142078199
2-chloro-4-methyl-N,N-dipropylaniline (PubChem CID 142078199) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 2-chloro-4-methyl-N,N-dipropylaniline.
| Compound Name | 2-chloro-4-methyl-N,N-dipropylaniline |
|---|---|
| PubChem CID | 142078199 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-chloro-4-methyl-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C13H20ClN/c1-4-8-15(9-5-2)13-7-6-11(3)10-12(13)14/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | YSGRCZJIEWNMHT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |