C14H26N2 — CID 144540155
methane;4-methyl-1-N,1-N-dipropylbenzene-1,2-diamine (PubChem CID 144540155) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is methane;4-methyl-1-N,1-N-dipropylbenzene-1,2-diamine.
| Compound Name | methane;4-methyl-1-N,1-N-dipropylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 144540155 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | methane;4-methyl-1-N,1-N-dipropylbenzene-1,2-diamine |
| SMILES | C.CCCN(CCC)c1ccc(C)cc1N |
| InChI | InChI=1S/C13H22N2.CH4/c1-4-8-15(9-5-2)13-7-6-11(3)10-12(13)14;/h6-7,10H,4-5,8-9,14H2,1-3H3;1H4 |
| InChIKey | XHPNYUJHINOMOA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|