C14H23N — CID 13113808
2,5-dimethyl-N,N-dipropylaniline (PubChem CID 13113808) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 2,5-dimethyl-N,N-dipropylaniline.
| Compound Name | 2,5-dimethyl-N,N-dipropylaniline |
|---|---|
| PubChem CID | 13113808 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 2,5-dimethyl-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1cc(C)ccc1C |
| InChI | InChI=1S/C14H23N/c1-5-9-15(10-6-2)14-11-12(3)7-8-13(14)4/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | FGDKLWIHSSCZBT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |