C16H28N2 — CID 55057054
2-(aminomethyl)-N,N-dibutyl-5-methylaniline (PubChem CID 55057054) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-dibutyl-5-methylaniline.
| Compound Name | 2-(aminomethyl)-N,N-dibutyl-5-methylaniline |
|---|---|
| PubChem CID | 55057054 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 2-(aminomethyl)-N,N-dibutyl-5-methylaniline |
| SMILES | CCCCN(CCCC)c1cc(C)ccc1CN |
| InChI | InChI=1S/C16H28N2/c1-4-6-10-18(11-7-5-2)16-12-14(3)8-9-15(16)13-17/h8-9,12H,4-7,10-11,13,17H2,1-3H3 |
| InChIKey | ZLFHIFWVDWNDCL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |