C12H21N — CID 143780972
(2,4-dimethylphenyl)methanamine;propane (PubChem CID 143780972) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2,4-dimethylphenyl)methanamine;propane.
| Compound Name | (2,4-dimethylphenyl)methanamine;propane |
|---|---|
| PubChem CID | 143780972 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2,4-dimethylphenyl)methanamine;propane |
| SMILES | CCC.Cc1ccc(CN)c(C)c1 |
| InChI | InChI=1S/C9H13N.C3H8/c1-7-3-4-9(6-10)8(2)5-7;1-3-2/h3-5H,6,10H2,1-2H3;3H2,1-2H3 |
| InChIKey | XCYKAXGQWMCJRO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |