C10H13NS — CID 82075040
2-(2,4-dimethylphenyl)ethanethioamide (PubChem CID 82075040) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)ethanethioamide.
| Compound Name | 2-(2,4-dimethylphenyl)ethanethioamide |
|---|---|
| PubChem CID | 82075040 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-(2,4-dimethylphenyl)ethanethioamide |
| SMILES | Cc1ccc(CC(N)=S)c(C)c1 |
| InChI | InChI=1S/C10H13NS/c1-7-3-4-9(6-10(11)12)8(2)5-7/h3-5H,6H2,1-2H3,(H2,11,12) |
| InChIKey | MBBWNYWSPQUWQU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|