C10H14N2S — CID 82075991
2-(2,4-dimethylanilino)ethanethioamide (PubChem CID 82075991) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)ethanethioamide.
| Compound Name | 2-(2,4-dimethylanilino)ethanethioamide |
|---|---|
| PubChem CID | 82075991 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(2,4-dimethylanilino)ethanethioamide |
| SMILES | Cc1ccc(NCC(N)=S)c(C)c1 |
| InChI | InChI=1S/C10H14N2S/c1-7-3-4-9(8(2)5-7)12-6-10(11)13/h3-5,12H,6H2,1-2H3,(H2,11,13) |
| InChIKey | QZNHNAZIEDOKNA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|