C10H14N2S — CID 107928326
2-(ethylamino)-5-methylbenzenecarbothioamide (PubChem CID 107928326) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-(ethylamino)-5-methylbenzenecarbothioamide.
| Compound Name | 2-(ethylamino)-5-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107928326 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(ethylamino)-5-methylbenzenecarbothioamide |
| SMILES | CCNc1ccc(C)cc1C(N)=S |
| InChI | InChI=1S/C10H14N2S/c1-3-12-9-5-4-7(2)6-8(9)10(11)13/h4-6,12H,3H2,1-2H3,(H2,11,13) |
| InChIKey | SRRRDLITAZGSTN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|