C17H26N2S — CID 107928838
2-[(4-ethylcyclohexyl)methylamino]-5-methylbenzenecarbothioamide (PubChem CID 107928838) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 2-[(4-ethylcyclohexyl)methylamino]-5-methylbenzenecarbothioamide.
| Compound Name | 2-[(4-ethylcyclohexyl)methylamino]-5-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107928838 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-[(4-ethylcyclohexyl)methylamino]-5-methylbenzenecarbothioamide |
| SMILES | CCC1CCC(CNc2ccc(C)cc2C(N)=S)CC1 |
| InChI | InChI=1S/C17H26N2S/c1-3-13-5-7-14(8-6-13)11-19-16-9-4-12(2)10-15(16)17(18)20/h4,9-10,13-14,19H,3,5-8,11H2,1-2H3,(H2,18,20) |
| InChIKey | GMFJMOXCVDDUNA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|