C13H20N2S2 — CID 114248077
2-(3-ethylsulfanylpropylamino)-5-methylbenzenecarbothioamide (PubChem CID 114248077) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 2-(3-ethylsulfanylpropylamino)-5-methylbenzenecarbothioamide.
| Compound Name | 2-(3-ethylsulfanylpropylamino)-5-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 114248077 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(3-ethylsulfanylpropylamino)-5-methylbenzenecarbothioamide |
| SMILES | CCSCCCNc1ccc(C)cc1C(N)=S |
| InChI | InChI=1S/C13H20N2S2/c1-3-17-8-4-7-15-12-6-5-10(2)9-11(12)13(14)16/h5-6,9,15H,3-4,7-8H2,1-2H3,(H2,14,16) |
| InChIKey | VBFMCBBFDLJVPA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|