C13H20N2S2 — CID 107929285
5-methyl-2-[(2-methyl-2-methylsulfanylpropyl)amino]benzenecarbothioamide (PubChem CID 107929285) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 5-methyl-2-[(2-methyl-2-methylsulfanylpropyl)amino]benzenecarbothioamide.
| Compound Name | 5-methyl-2-[(2-methyl-2-methylsulfanylpropyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107929285 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-methyl-2-[(2-methyl-2-methylsulfanylpropyl)amino]benzenecarbothioamide |
| SMILES | CSC(C)(C)CNc1ccc(C)cc1C(N)=S |
| InChI | InChI=1S/C13H20N2S2/c1-9-5-6-11(10(7-9)12(14)16)15-8-13(2,3)17-4/h5-7,15H,8H2,1-4H3,(H2,14,16) |
| InChIKey | NBPKIKOYHJLHBJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|