C10H13ClN2S2 — CID 63957410
5-chloro-2-(2-methylsulfanylethylamino)benzenecarbothioamide (PubChem CID 63957410) has the molecular formula C10H13ClN2S2 and a molecular weight of 260.81 g/mol. Its IUPAC name is 5-chloro-2-(2-methylsulfanylethylamino)benzenecarbothioamide.
| Compound Name | 5-chloro-2-(2-methylsulfanylethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63957410 |
| Molecular Formula | C10H13ClN2S2 |
| Molecular Weight | 260.81 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 5-chloro-2-(2-methylsulfanylethylamino)benzenecarbothioamide |
| SMILES | CSCCNc1ccc(Cl)cc1C(N)=S |
| InChI | InChI=1S/C10H13ClN2S2/c1-15-5-4-13-9-3-2-7(11)6-8(9)10(12)14/h2-3,6,13H,4-5H2,1H3,(H2,12,14) |
| InChIKey | OMFYYSBUXBUTQH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|