C11H16ClN3S — CID 62493997
5-chloro-2-[2-(dimethylamino)ethylamino]benzenecarbothioamide (PubChem CID 62493997) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is 5-chloro-2-[2-(dimethylamino)ethylamino]benzenecarbothioamide.
| Compound Name | 5-chloro-2-[2-(dimethylamino)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 62493997 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 5-chloro-2-[2-(dimethylamino)ethylamino]benzenecarbothioamide |
| SMILES | CN(C)CCNc1ccc(Cl)cc1C(N)=S |
| InChI | InChI=1S/C11H16ClN3S/c1-15(2)6-5-14-10-4-3-8(12)7-9(10)11(13)16/h3-4,7,14H,5-6H2,1-2H3,(H2,13,16) |
| InChIKey | XWEVDBJWDMJGOU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|