C11H16FN3S — CID 63673179
2-[2-(dimethylamino)ethylamino]-5-fluorobenzenecarbothioamide (PubChem CID 63673179) has the molecular formula C11H16FN3S and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-5-fluorobenzenecarbothioamide.
| Compound Name | 2-[2-(dimethylamino)ethylamino]-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63673179 |
| Molecular Formula | C11H16FN3S |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[2-(dimethylamino)ethylamino]-5-fluorobenzenecarbothioamide |
| SMILES | CN(C)CCNc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C11H16FN3S/c1-15(2)6-5-14-10-4-3-8(12)7-9(10)11(13)16/h3-4,7,14H,5-6H2,1-2H3,(H2,13,16) |
| InChIKey | SPBLPAFWPQDLMM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|