C10H14F2N2 — CID 23540138
N-(2,4-difluorophenyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 23540138) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(2,4-difluorophenyl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 23540138 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1ccc(F)cc1F |
| InChI | InChI=1S/C10H14F2N2/c1-14(2)6-5-13-10-4-3-8(11)7-9(10)12/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | RPJDUMZJVIAHDD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |