C10H13F3N2 — CID 62809389
N',N'-dimethyl-N-(2,3,5-trifluorophenyl)ethane-1,2-diamine (PubChem CID 62809389) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2,3,5-trifluorophenyl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(2,3,5-trifluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62809389 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | N',N'-dimethyl-N-(2,3,5-trifluorophenyl)ethane-1,2-diamine |
| SMILES | CN(C)CCNc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C10H13F3N2/c1-15(2)4-3-14-9-6-7(11)5-8(12)10(9)13/h5-6,14H,3-4H2,1-2H3 |
| InChIKey | AKGIQFLBCZXKFY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|