C10H12F3NO2 — CID 62810263
2-[2-(2,3,5-trifluoroanilino)ethoxy]ethanol (PubChem CID 62810263) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-[2-(2,3,5-trifluoroanilino)ethoxy]ethanol.
| Compound Name | 2-[2-(2,3,5-trifluoroanilino)ethoxy]ethanol |
|---|---|
| PubChem CID | 62810263 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[2-(2,3,5-trifluoroanilino)ethoxy]ethanol |
| SMILES | OCCOCCNc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C10H12F3NO2/c11-7-5-8(12)10(13)9(6-7)14-1-3-16-4-2-15/h5-6,14-15H,1-4H2 |
| InChIKey | RHEXUNMAKXMCJK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|