C10H12Br3NO2 — CID 61070527
2-[2-(2,4,6-tribromoanilino)ethoxy]ethanol (PubChem CID 61070527) has the molecular formula C10H12Br3NO2 and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-[2-(2,4,6-tribromoanilino)ethoxy]ethanol.
| Compound Name | 2-[2-(2,4,6-tribromoanilino)ethoxy]ethanol |
|---|---|
| PubChem CID | 61070527 |
| Molecular Formula | C10H12Br3NO2 |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 414.84 |
| IUPAC Name | 2-[2-(2,4,6-tribromoanilino)ethoxy]ethanol |
| SMILES | OCCOCCNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C10H12Br3NO2/c11-7-5-8(12)10(9(13)6-7)14-1-3-16-4-2-15/h5-6,14-15H,1-4H2 |
| InChIKey | FCSAINDJKOKHSL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|