C11H15Br3N2 — CID 114525073
N',N'-dimethyl-N-(2,4,6-tribromophenyl)propane-1,3-diamine (PubChem CID 114525073) has the molecular formula C11H15Br3N2 and a molecular weight of 414.97 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2,4,6-tribromophenyl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(2,4,6-tribromophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114525073 |
| Molecular Formula | C11H15Br3N2 |
| Molecular Weight | 414.97 g/mol |
| Exact Mass | 411.88 |
| IUPAC Name | N',N'-dimethyl-N-(2,4,6-tribromophenyl)propane-1,3-diamine |
| SMILES | CN(C)CCCNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H15Br3N2/c1-16(2)5-3-4-15-11-9(13)6-8(12)7-10(11)14/h6-7,15H,3-5H2,1-2H3 |
| InChIKey | NCQOTQHWRSXLRJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|