C11H13Br3N2O — CID 63891830
N-methyl-4-(2,4,6-tribromoanilino)butanamide (PubChem CID 63891830) has the molecular formula C11H13Br3N2O and a molecular weight of 428.95 g/mol. Its IUPAC name is N-methyl-4-(2,4,6-tribromoanilino)butanamide.
| Compound Name | N-methyl-4-(2,4,6-tribromoanilino)butanamide |
|---|---|
| PubChem CID | 63891830 |
| Molecular Formula | C11H13Br3N2O |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 425.86 |
| IUPAC Name | N-methyl-4-(2,4,6-tribromoanilino)butanamide |
| SMILES | CNC(=O)CCCNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br3N2O/c1-15-10(17)3-2-4-16-11-8(13)5-7(12)6-9(11)14/h5-6,16H,2-4H2,1H3,(H,15,17) |
| InChIKey | GAECJYBYEBYROZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|