C14H19Br3N2O — CID 65292805
6-amino-4,4-dimethyl-N-(2,4,6-tribromophenyl)hexanamide (PubChem CID 65292805) has the molecular formula C14H19Br3N2O and a molecular weight of 471.03 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-N-(2,4,6-tribromophenyl)hexanamide.
| Compound Name | 6-amino-4,4-dimethyl-N-(2,4,6-tribromophenyl)hexanamide |
|---|---|
| PubChem CID | 65292805 |
| Molecular Formula | C14H19Br3N2O |
| Molecular Weight | 471.03 g/mol |
| Exact Mass | 467.90 |
| IUPAC Name | 6-amino-4,4-dimethyl-N-(2,4,6-tribromophenyl)hexanamide |
| SMILES | CC(C)(CCN)CCC(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C14H19Br3N2O/c1-14(2,5-6-18)4-3-12(20)19-13-10(16)7-9(15)8-11(13)17/h7-8H,3-6,18H2,1-2H3,(H,19,20) |
| InChIKey | ANRUCMCHVBUGGZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.03 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |