C14H20Br2N2O — CID 65290987
6-amino-N-(2,4-dibromophenyl)-4,4-dimethylhexanamide (PubChem CID 65290987) has the molecular formula C14H20Br2N2O and a molecular weight of 392.14 g/mol. Its IUPAC name is 6-amino-N-(2,4-dibromophenyl)-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-(2,4-dibromophenyl)-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 65290987 |
| Molecular Formula | C14H20Br2N2O |
| Molecular Weight | 392.14 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 6-amino-N-(2,4-dibromophenyl)-4,4-dimethylhexanamide |
| SMILES | CC(C)(CCN)CCC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H20Br2N2O/c1-14(2,7-8-17)6-5-13(19)18-12-4-3-10(15)9-11(12)16/h3-4,9H,5-8,17H2,1-2H3,(H,18,19) |
| InChIKey | HHJOCLCEJJXGMY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.14 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |