C11H13Br2ClN2O — CID 114209129
5-amino-N-(2,6-dibromo-4-chlorophenyl)pentanamide (PubChem CID 114209129) has the molecular formula C11H13Br2ClN2O and a molecular weight of 384.50 g/mol. Its IUPAC name is 5-amino-N-(2,6-dibromo-4-chlorophenyl)pentanamide.
| Compound Name | 5-amino-N-(2,6-dibromo-4-chlorophenyl)pentanamide |
|---|---|
| PubChem CID | 114209129 |
| Molecular Formula | C11H13Br2ClN2O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 381.91 |
| IUPAC Name | 5-amino-N-(2,6-dibromo-4-chlorophenyl)pentanamide |
| SMILES | NCCCCC(=O)Nc1c(Br)cc(Cl)cc1Br |
| InChI | InChI=1S/C11H13Br2ClN2O/c12-8-5-7(14)6-9(13)11(8)16-10(17)3-1-2-4-15/h5-6H,1-4,15H2,(H,16,17) |
| InChIKey | BXVKNHYNRYYBHT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|