C13H15Br2NO3 — CID 54867481
6-(2,6-dibromo-4-methylanilino)-6-oxohexanoic acid (PubChem CID 54867481) has the molecular formula C13H15Br2NO3 and a molecular weight of 393.08 g/mol. Its IUPAC name is 6-(2,6-dibromo-4-methylanilino)-6-oxohexanoic acid.
| Compound Name | 6-(2,6-dibromo-4-methylanilino)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 54867481 |
| Molecular Formula | C13H15Br2NO3 |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | 6-(2,6-dibromo-4-methylanilino)-6-oxohexanoic acid |
| SMILES | Cc1cc(Br)c(NC(=O)CCCCC(=O)O)c(Br)c1 |
| InChI | InChI=1S/C13H15Br2NO3/c1-8-6-9(14)13(10(15)7-8)16-11(17)4-2-3-5-12(18)19/h6-7H,2-5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | ZLMSXAGSASXKBS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|