C12H13Br2NO3S — CID 43237306
3-[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 43237306) has the molecular formula C12H13Br2NO3S and a molecular weight of 411.12 g/mol. Its IUPAC name is 3-[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43237306 |
| Molecular Formula | C12H13Br2NO3S |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 408.90 |
| IUPAC Name | 3-[2-(2,6-dibromo-4-methylanilino)-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | Cc1cc(Br)c(NC(=O)CSCCC(=O)O)c(Br)c1 |
| InChI | InChI=1S/C12H13Br2NO3S/c1-7-4-8(13)12(9(14)5-7)15-10(16)6-19-3-2-11(17)18/h4-5H,2-3,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | FYWNSQYAFVKCRX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|