C11H10I3NO3S — CID 55026228
3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid (PubChem CID 55026228) has the molecular formula C11H10I3NO3S and a molecular weight of 616.98 g/mol. Its IUPAC name is 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 55026228 |
| Molecular Formula | C11H10I3NO3S |
| Molecular Weight | 616.98 g/mol |
| Exact Mass | 616.75 |
| IUPAC Name | 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSCC(=O)Nc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C11H10I3NO3S/c12-6-3-7(13)11(8(14)4-6)15-9(16)5-19-2-1-10(17)18/h3-4H,1-2,5H2,(H,15,16)(H,17,18) |
| InChIKey | IKFSOWINWINZHB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.98 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|