3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid

C11H10I3NO3S — CID 55026228

IUPAC3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid
SMILESO=C(O)CCSCC(=O)Nc1c(I)cc(I)cc1I
InChIInChI=1S/C11H10I3NO3S/c12-6-3-7(13)11(8(14)4-6)15-9(16)5-19-2-1-10(17)18/h3-4H,1-2,5H2,(H,15,16)(H,17,18)
InChIKeyIKFSOWINWINZHB-UHFFFAOYSA-N
MW616.98 g/mol
LogP3.65
Rot. Bonds6

About 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid

3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid (PubChem CID 55026228) has the molecular formula C11H10I3NO3S and a molecular weight of 616.98 g/mol. Its IUPAC name is 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid.

Molecular Properties

Compound Name3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid
PubChem CID55026228
Molecular FormulaC11H10I3NO3S
Molecular Weight616.98 g/mol
Exact Mass616.75
IUPAC Name3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid
SMILESO=C(O)CCSCC(=O)Nc1c(I)cc(I)cc1I
InChIInChI=1S/C11H10I3NO3S/c12-6-3-7(13)11(8(14)4-6)15-9(16)5-19-2-1-10(17)18/h3-4H,1-2,5H2,(H,15,16)(H,17,18)
InChIKeyIKFSOWINWINZHB-UHFFFAOYSA-N
XLogP3.65
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500616.98
LogP ≤ 53.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid?
The IUPAC name of 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid (CID 55026228) is 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid.
What is the SMILES notation for 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid?
The canonical SMILES for 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid is O=C(O)CCSCC(=O)Nc1c(I)cc(I)cc1I.
What is the InChIKey of 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid?
The InChIKey is IKFSOWINWINZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10I3NO3S/c12-6-3-7(13)11(8(14)4-6)15-9(16)5-19-2-1-10(17)18/h3-4H,1-2,5H2,(H,15,16)(H,17,18).
What are the key properties of 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid?
3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid has a molecular weight of 616.98 g/mol, XLogP of 3.65, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]sulfanylpropanoic acid is sourced from PubChem (CID 55026228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).