C13H13I3N2O3 — CID 64618325
2-[1-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]azetidin-3-yl]acetic acid (PubChem CID 64618325) has the molecular formula C13H13I3N2O3 and a molecular weight of 625.97 g/mol. Its IUPAC name is 2-[1-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64618325 |
| Molecular Formula | C13H13I3N2O3 |
| Molecular Weight | 625.97 g/mol |
| Exact Mass | 625.81 |
| IUPAC Name | 2-[1-[2-oxo-2-(2,4,6-triiodoanilino)ethyl]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(CC(=O)Nc2c(I)cc(I)cc2I)C1 |
| InChI | InChI=1S/C13H13I3N2O3/c14-8-2-9(15)13(10(16)3-8)17-11(19)6-18-4-7(5-18)1-12(20)21/h2-3,7H,1,4-6H2,(H,17,19)(H,20,21) |
| InChIKey | FLVKLDMESYXSDT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.97 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|