C14H17IN2O3 — CID 64617120
2-[1-[2-(4-iodo-2-methylanilino)-2-oxoethyl]azetidin-3-yl]acetic acid (PubChem CID 64617120) has the molecular formula C14H17IN2O3 and a molecular weight of 388.21 g/mol. Its IUPAC name is 2-[1-[2-(4-iodo-2-methylanilino)-2-oxoethyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-(4-iodo-2-methylanilino)-2-oxoethyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64617120 |
| Molecular Formula | C14H17IN2O3 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 2-[1-[2-(4-iodo-2-methylanilino)-2-oxoethyl]azetidin-3-yl]acetic acid |
| SMILES | Cc1cc(I)ccc1NC(=O)CN1CC(CC(=O)O)C1 |
| InChI | InChI=1S/C14H17IN2O3/c1-9-4-11(15)2-3-12(9)16-13(18)8-17-6-10(7-17)5-14(19)20/h2-4,10H,5-8H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | QEBAYEMPPPTWIZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|