C15H20IN3O — CID 60973242
2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 60973242) has the molecular formula C15H20IN3O and a molecular weight of 385.25 g/mol. Its IUPAC name is 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 60973242 |
| Molecular Formula | C15H20IN3O |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CN1CC2CNCC2C1 |
| InChI | InChI=1S/C15H20IN3O/c1-10-4-13(16)2-3-14(10)18-15(20)9-19-7-11-5-17-6-12(11)8-19/h2-4,11-12,17H,5-9H2,1H3,(H,18,20) |
| InChIKey | OYOIXMKIGKQWCQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|