C15H19IN2O3 — CID 112731432
methyl 1-[2-(4-iodo-2-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylate (PubChem CID 112731432) has the molecular formula C15H19IN2O3 and a molecular weight of 402.23 g/mol. Its IUPAC name is methyl 1-[2-(4-iodo-2-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[2-(4-iodo-2-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 112731432 |
| Molecular Formula | C15H19IN2O3 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | methyl 1-[2-(4-iodo-2-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(CC(=O)Nc2ccc(I)cc2C)C1 |
| InChI | InChI=1S/C15H19IN2O3/c1-10-7-12(16)3-4-13(10)17-14(19)9-18-6-5-11(8-18)15(20)21-2/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,17,19) |
| InChIKey | SDZMLGODPYNISA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|