C16H24IN3O — CID 115305243
N-(4-iodo-2-methylphenyl)-2-[4-methyl-4-(methylamino)piperidin-1-yl]acetamide (PubChem CID 115305243) has the molecular formula C16H24IN3O and a molecular weight of 401.29 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-[4-methyl-4-(methylamino)piperidin-1-yl]acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-[4-methyl-4-(methylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 115305243 |
| Molecular Formula | C16H24IN3O |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-[4-methyl-4-(methylamino)piperidin-1-yl]acetamide |
| SMILES | CNC1(C)CCN(CC(=O)Nc2ccc(I)cc2C)CC1 |
| InChI | InChI=1S/C16H24IN3O/c1-12-10-13(17)4-5-14(12)19-15(21)11-20-8-6-16(2,18-3)7-9-20/h4-5,10,18H,6-9,11H2,1-3H3,(H,19,21) |
| InChIKey | VJSCUHXTPHROIC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|