C10H13BrN2OS — CID 116813465
N-(2-amino-6-bromo-4-methylphenyl)-2-methylsulfanylacetamide (PubChem CID 116813465) has the molecular formula C10H13BrN2OS and a molecular weight of 289.20 g/mol. Its IUPAC name is N-(2-amino-6-bromo-4-methylphenyl)-2-methylsulfanylacetamide.
| Compound Name | N-(2-amino-6-bromo-4-methylphenyl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 116813465 |
| Molecular Formula | C10H13BrN2OS |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | N-(2-amino-6-bromo-4-methylphenyl)-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)Nc1c(N)cc(C)cc1Br |
| InChI | InChI=1S/C10H13BrN2OS/c1-6-3-7(11)10(8(12)4-6)13-9(14)5-15-2/h3-4H,5,12H2,1-2H3,(H,13,14) |
| InChIKey | ZJIYHPUWTFDHGX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|