C9H10Cl2N2OS — CID 61023180
N-(4-amino-2,6-dichlorophenyl)-2-methylsulfanylacetamide (PubChem CID 61023180) has the molecular formula C9H10Cl2N2OS and a molecular weight of 265.17 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-methylsulfanylacetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 61023180 |
| Molecular Formula | C9H10Cl2N2OS |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C9H10Cl2N2OS/c1-15-4-8(14)13-9-6(10)2-5(12)3-7(9)11/h2-3H,4,12H2,1H3,(H,13,14) |
| InChIKey | FZHVZKIMHMZFQJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|