C13H16Cl2N2O2S — CID 107748372
N-(4-amino-2,6-dichlorophenyl)-2-(2-methyloxolan-3-yl)sulfanylacetamide (PubChem CID 107748372) has the molecular formula C13H16Cl2N2O2S and a molecular weight of 335.26 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-(2-methyloxolan-3-yl)sulfanylacetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-(2-methyloxolan-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 107748372 |
| Molecular Formula | C13H16Cl2N2O2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-(2-methyloxolan-3-yl)sulfanylacetamide |
| SMILES | CC1OCCC1SCC(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2S/c1-7-11(2-3-19-7)20-6-12(18)17-13-9(14)4-8(16)5-10(13)15/h4-5,7,11H,2-3,6,16H2,1H3,(H,17,18) |
| InChIKey | VIHPZBVOEQNTSR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|