C10H12Cl2N2O3S — CID 43382327
N-(4-amino-2,6-dichlorophenyl)-2-ethylsulfonylacetamide (PubChem CID 43382327) has the molecular formula C10H12Cl2N2O3S and a molecular weight of 311.19 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-ethylsulfonylacetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-ethylsulfonylacetamide |
|---|---|
| PubChem CID | 43382327 |
| Molecular Formula | C10H12Cl2N2O3S |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-ethylsulfonylacetamide |
| SMILES | CCS(=O)(=O)CC(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O3S/c1-2-18(16,17)5-9(15)14-10-7(11)3-6(13)4-8(10)12/h3-4H,2,5,13H2,1H3,(H,14,15) |
| InChIKey | UXZSVFBKPQUVBS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|