C14H21Cl2N3O2 — CID 107198287
N-(4-amino-2,6-dichlorophenyl)-2-[5-hydroxypentyl(methyl)amino]acetamide (PubChem CID 107198287) has the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.25 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-[5-hydroxypentyl(methyl)amino]acetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-[5-hydroxypentyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 107198287 |
| Molecular Formula | C14H21Cl2N3O2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-[5-hydroxypentyl(methyl)amino]acetamide |
| SMILES | CN(CCCCCO)CC(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C14H21Cl2N3O2/c1-19(5-3-2-4-6-20)9-13(21)18-14-11(15)7-10(17)8-12(14)16/h7-8,20H,2-6,9,17H2,1H3,(H,18,21) |
| InChIKey | WXABGDOVRZYMSX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|