C14H19Cl2N3O — CID 62861622
N-(4-amino-2,6-dichlorophenyl)-2-[cyclobutylmethyl(methyl)amino]acetamide (PubChem CID 62861622) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-[cyclobutylmethyl(methyl)amino]acetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-[cyclobutylmethyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 62861622 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-[cyclobutylmethyl(methyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cc(N)cc1Cl)CC1CCC1 |
| InChI | InChI=1S/C14H19Cl2N3O/c1-19(7-9-3-2-4-9)8-13(20)18-14-11(15)5-10(17)6-12(14)16/h5-6,9H,2-4,7-8,17H2,1H3,(H,18,20) |
| InChIKey | ZUTKLLRRAGUABU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|