C9H7Cl2F3N2O — CID 16778408
N-(4-amino-2,6-dichlorophenyl)-3,3,3-trifluoropropanamide (PubChem CID 16778408) has the molecular formula C9H7Cl2F3N2O and a molecular weight of 287.07 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 16778408 |
| Molecular Formula | C9H7Cl2F3N2O |
| Molecular Weight | 287.07 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-3,3,3-trifluoropropanamide |
| SMILES | Nc1cc(Cl)c(NC(=O)CC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2F3N2O/c10-5-1-4(15)2-6(11)8(5)16-7(17)3-9(12,13)14/h1-2H,3,15H2,(H,16,17) |
| InChIKey | MDPJXOMWPCXHCN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.07 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|