C11H8Cl2F3NO3 — CID 82830697
3,5-dichloro-4-(4,4,4-trifluorobutanoylamino)benzoic acid (PubChem CID 82830697) has the molecular formula C11H8Cl2F3NO3 and a molecular weight of 330.09 g/mol. Its IUPAC name is 3,5-dichloro-4-(4,4,4-trifluorobutanoylamino)benzoic acid.
| Compound Name | 3,5-dichloro-4-(4,4,4-trifluorobutanoylamino)benzoic acid |
|---|---|
| PubChem CID | 82830697 |
| Molecular Formula | C11H8Cl2F3NO3 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 3,5-dichloro-4-(4,4,4-trifluorobutanoylamino)benzoic acid |
| SMILES | O=C(CCC(F)(F)F)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H8Cl2F3NO3/c12-6-3-5(10(19)20)4-7(13)9(6)17-8(18)1-2-11(14,15)16/h3-4H,1-2H2,(H,17,18)(H,19,20) |
| InChIKey | UUMWBOMZJKQNQA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |