C10H8Cl2F3NO2 — CID 104625918
N-(3,5-dichloro-2-hydroxyphenyl)-4,4,4-trifluorobutanamide (PubChem CID 104625918) has the molecular formula C10H8Cl2F3NO2 and a molecular weight of 302.08 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 104625918 |
| Molecular Formula | C10H8Cl2F3NO2 |
| Molecular Weight | 302.08 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H8Cl2F3NO2/c11-5-3-6(12)9(18)7(4-5)16-8(17)1-2-10(13,14)15/h3-4,18H,1-2H2,(H,16,17) |
| InChIKey | KXXPWEOGAKQYAA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.08 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|