C9H7BrClF3N2O — CID 102979349
N-(5-bromo-2-chloro-3-pyridinyl)-4,4,4-trifluorobutanamide (PubChem CID 102979349) has the molecular formula C9H7BrClF3N2O and a molecular weight of 331.52 g/mol. Its IUPAC name is N-(5-bromo-2-chloro-3-pyridinyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(5-bromo-2-chloro-3-pyridinyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 102979349 |
| Molecular Formula | C9H7BrClF3N2O |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | N-(5-bromo-2-chloro-3-pyridinyl)-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1cc(Br)cnc1Cl |
| InChI | InChI=1S/C9H7BrClF3N2O/c10-5-3-6(8(11)15-4-5)16-7(17)1-2-9(12,13)14/h3-4H,1-2H2,(H,16,17) |
| InChIKey | XYZITHANUILRCN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|