C16H23Cl2NO2 — CID 107675883
N-(3,5-dichloro-2-hydroxyphenyl)decanamide (PubChem CID 107675883) has the molecular formula C16H23Cl2NO2 and a molecular weight of 332.27 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)decanamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)decanamide |
|---|---|
| PubChem CID | 107675883 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H23Cl2NO2/c1-2-3-4-5-6-7-8-9-15(20)19-14-11-12(17)10-13(18)16(14)21/h10-11,21H,2-9H2,1H3,(H,19,20) |
| InChIKey | CQGXJZMCYRTKNZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|