C12H15Cl2NO3 — CID 103891151
N-(3,5-dichloro-2-hydroxyphenyl)-4-ethoxybutanamide (PubChem CID 103891151) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-4-ethoxybutanamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-4-ethoxybutanamide |
|---|---|
| PubChem CID | 103891151 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-4-ethoxybutanamide |
| SMILES | CCOCCCC(=O)Nc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H15Cl2NO3/c1-2-18-5-3-4-11(16)15-10-7-8(13)6-9(14)12(10)17/h6-7,17H,2-5H2,1H3,(H,15,16) |
| InChIKey | HAZWVXFXLVPOPK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|