C16H19ClN2O2 — CID 56530387
N-(4-chloro-2-pyrrol-1-ylphenyl)-4-ethoxybutanamide (PubChem CID 56530387) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is N-(4-chloro-2-pyrrol-1-ylphenyl)-4-ethoxybutanamide.
| Compound Name | N-(4-chloro-2-pyrrol-1-ylphenyl)-4-ethoxybutanamide |
|---|---|
| PubChem CID | 56530387 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-(4-chloro-2-pyrrol-1-ylphenyl)-4-ethoxybutanamide |
| SMILES | CCOCCCC(=O)Nc1ccc(Cl)cc1-n1cccc1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-2-21-11-5-6-16(20)18-14-8-7-13(17)12-15(14)19-9-3-4-10-19/h3-4,7-10,12H,2,5-6,11H2,1H3,(H,18,20) |
| InChIKey | ROJBNQAXENJYIZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|