C13H13Cl2N3O2 — CID 103891137
N-(3,5-dichloro-2-hydroxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 103891137) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 103891137 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)Nc2cc(Cl)cc(Cl)c2O)n1 |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-7-3-8(2)18(17-7)6-12(19)16-11-5-9(14)4-10(15)13(11)20/h3-5,20H,6H2,1-2H3,(H,16,19) |
| InChIKey | UNWQLEUPDIKBAN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|