C13H14Cl2N4O — CID 29276076
N-(2-amino-4,6-dichlorophenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 29276076) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 29276076 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)Nc2c(N)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H14Cl2N4O/c1-7-3-8(2)19(18-7)6-12(20)17-13-10(15)4-9(14)5-11(13)16/h3-5H,6,16H2,1-2H3,(H,17,20) |
| InChIKey | YLLBKGPEUHJCMA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|