C10H9Cl2N5O — CID 16788926
N-(2-amino-4,6-dichlorophenyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 16788926) has the molecular formula C10H9Cl2N5O and a molecular weight of 286.12 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 16788926 |
| Molecular Formula | C10H9Cl2N5O |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1NC(=O)Cn1cncn1 |
| InChI | InChI=1S/C10H9Cl2N5O/c11-6-1-7(12)10(8(13)2-6)16-9(18)3-17-5-14-4-15-17/h1-2,4-5H,3,13H2,(H,16,18) |
| InChIKey | WONIQLCVCHKDAX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|