C10H8BrClN4O — CID 103479652
N-(2-bromo-3-chlorophenyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 103479652) has the molecular formula C10H8BrClN4O and a molecular weight of 315.56 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 103479652 |
| Molecular Formula | C10H8BrClN4O |
| Molecular Weight | 315.56 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C10H8BrClN4O/c11-10-7(12)2-1-3-8(10)15-9(17)4-16-6-13-5-14-16/h1-3,5-6H,4H2,(H,15,17) |
| InChIKey | RMUZLXMFAWEPJN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |